C14H12BrN3O2S — CID 115321988
3-(3-bromo-4-methoxyphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 115321988) has the molecular formula C14H12BrN3O2S and a molecular weight of 366.24 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 115321988 |
| Molecular Formula | C14H12BrN3O2S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | COc1ccc2[nH]c(=S)n(-c3ccc(OC)c(Br)c3)c2n1 |
| InChI | InChI=1S/C14H12BrN3O2S/c1-19-11-5-3-8(7-9(11)15)18-13-10(16-14(18)21)4-6-12(17-13)20-2/h3-7H,1-2H3,(H,16,21) |
| InChIKey | PUSXJKHWVZYAFR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|