C11H11N5OS — CID 113286822
5-methoxy-3-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 113286822) has the molecular formula C11H11N5OS and a molecular weight of 261.31 g/mol. Its IUPAC name is 5-methoxy-3-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 5-methoxy-3-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 113286822 |
| Molecular Formula | C11H11N5OS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-methoxy-3-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | COc1ccc2[nH]c(=S)n(-c3cnn(C)c3)c2n1 |
| InChI | InChI=1S/C11H11N5OS/c1-15-6-7(5-12-15)16-10-8(13-11(16)18)3-4-9(14-10)17-2/h3-6H,1-2H3,(H,13,18) |
| InChIKey | AZNHQDADRFFYLC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|