C12H15N3OS — CID 113286821
3-(2-cyclopropylethyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 113286821) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-(2-cyclopropylethyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-(2-cyclopropylethyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 113286821 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-(2-cyclopropylethyl)-5-methoxy-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | COc1ccc2[nH]c(=S)n(CCC3CC3)c2n1 |
| InChI | InChI=1S/C12H15N3OS/c1-16-10-5-4-9-11(14-10)15(12(17)13-9)7-6-8-2-3-8/h4-5,8H,2-3,6-7H2,1H3,(H,13,17) |
| InChIKey | CQMALKSSPJTSEV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|