C12H13N5OS — CID 115321762
5-methoxy-3-(2-pyrazol-1-ylethyl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 115321762) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 5-methoxy-3-(2-pyrazol-1-ylethyl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 5-methoxy-3-(2-pyrazol-1-ylethyl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 115321762 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-methoxy-3-(2-pyrazol-1-ylethyl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | COc1ccc2[nH]c(=S)n(CCn3cccn3)c2n1 |
| InChI | InChI=1S/C12H13N5OS/c1-18-10-4-3-9-11(15-10)17(12(19)14-9)8-7-16-6-2-5-13-16/h2-6H,7-8H2,1H3,(H,14,19) |
| InChIKey | QCYLPFLOIFGIJZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|