C11H10N4O2S2 — CID 106382474
4-[(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382474) has the molecular formula C11H10N4O2S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-[(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382474 |
| Molecular Formula | C11H10N4O2S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-[(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)methyl]-3H-1,3-thiazol-2-one |
| SMILES | COc1ccc2[nH]c(=S)n(Cc3csc(=O)[nH]3)c2n1 |
| InChI | InChI=1S/C11H10N4O2S2/c1-17-8-3-2-7-9(14-8)15(10(18)13-7)4-6-5-19-11(16)12-6/h2-3,5H,4H2,1H3,(H,12,16)(H,13,18) |
| InChIKey | RDZVMXJHYQBAFD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|