C11H12F3N3OS — CID 115520833
5-methoxy-3-(4,4,4-trifluorobutyl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 115520833) has the molecular formula C11H12F3N3OS and a molecular weight of 291.30 g/mol. Its IUPAC name is 5-methoxy-3-(4,4,4-trifluorobutyl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 5-methoxy-3-(4,4,4-trifluorobutyl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 115520833 |
| Molecular Formula | C11H12F3N3OS |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 5-methoxy-3-(4,4,4-trifluorobutyl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | COc1ccc2[nH]c(=S)n(CCCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C11H12F3N3OS/c1-18-8-4-3-7-9(16-8)17(10(19)15-7)6-2-5-11(12,13)14/h3-4H,2,5-6H2,1H3,(H,15,19) |
| InChIKey | AMTDBCNGQBAOOK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|