C10H11F3N4OS — CID 115520838
6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione (PubChem CID 115520838) has the molecular formula C10H11F3N4OS and a molecular weight of 292.29 g/mol. Its IUPAC name is 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione.
| Compound Name | 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione |
|---|---|
| PubChem CID | 115520838 |
| Molecular Formula | C10H11F3N4OS |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione |
| SMILES | COc1ncnc2c1[nH]c(=S)n2CCCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N4OS/c1-18-8-6-7(14-5-15-8)17(9(19)16-6)4-2-3-10(11,12)13/h5H,2-4H2,1H3,(H,16,19) |
| InChIKey | VNCPLXUKIDSIFW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|