About 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione
6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione (PubChem CID 115520838) has the molecular formula C10H11F3N4OS
and a molecular weight of 292.29 g/mol. Its IUPAC name is 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione.
Molecular Properties
| Compound Name | 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione |
| PubChem CID | 115520838 |
| Molecular Formula | C10H11F3N4OS |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione |
| SMILES | COc1ncnc2c1[nH]c(=S)n2CCCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N4OS/c1-18-8-6-7(14-5-15-8)17(9(19)16-6)4-2-3-10(11,12)13/h5H,2-4H2,1H3,(H,16,19) |
| InChIKey | VNCPLXUKIDSIFW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione?
The IUPAC name of 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione (CID 115520838) is 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione.
What is the SMILES notation for 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione?
The canonical SMILES for 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione is COc1ncnc2c1[nH]c(=S)n2CCCC(F)(F)F.
What is the InChIKey of 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione?
The InChIKey is VNCPLXUKIDSIFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N4OS/c1-18-8-6-7(14-5-15-8)17(9(19)16-6)4-2-3-10(11,12)13/h5H,2-4H2,1H3,(H,16,19).
What are the key properties of 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione?
6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione has a molecular weight of 292.29 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-9-(4,4,4-trifluorobutyl)-7H-purine-8-thione is sourced from PubChem (CID 115520838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).