C12H11N3O2S2 — CID 106382466
4-[(6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382466) has the molecular formula C12H11N3O2S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[(6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382466 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 4-[(6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)methyl]-3H-1,3-thiazol-2-one |
| SMILES | COc1ccc2[nH]c(=S)n(Cc3csc(=O)[nH]3)c2c1 |
| InChI | InChI=1S/C12H11N3O2S2/c1-17-8-2-3-9-10(4-8)15(11(18)14-9)5-7-6-19-12(16)13-7/h2-4,6H,5H2,1H3,(H,13,16)(H,14,18) |
| InChIKey | MNHNWYJPUKWKDF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|