C15H17N5O2 — CID 82464367
7-ethyl-8-(ethylamino)-3-phenylpurine-2,6-dione (PubChem CID 82464367) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 7-ethyl-8-(ethylamino)-3-phenylpurine-2,6-dione.
| Compound Name | 7-ethyl-8-(ethylamino)-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464367 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 7-ethyl-8-(ethylamino)-3-phenylpurine-2,6-dione |
| SMILES | CCNc1nc2c(c(=O)[nH]c(=O)n2-c2ccccc2)n1CC |
| InChI | InChI=1S/C15H17N5O2/c1-3-16-14-17-12-11(19(14)4-2)13(21)18-15(22)20(12)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H,16,17)(H,18,21,22) |
| InChIKey | DJQSWECOWXHRSN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |