C23H19N3O4 — CID 70822166
ethyl 7-methyl-2,4-dioxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 70822166) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is ethyl 7-methyl-2,4-dioxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-methyl-2,4-dioxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 70822166 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | ethyl 7-methyl-2,4-dioxo-1,5-diphenylpyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2c(c1-c1ccccc1)c(=O)[nH]c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C23H19N3O4/c1-3-30-22(28)17-14(2)24-20-19(18(17)15-10-6-4-7-11-15)21(27)25-23(29)26(20)16-12-8-5-9-13-16/h4-13H,3H2,1-2H3,(H,25,27,29) |
| InChIKey | WILZIXIEILQBSJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |