About ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate
ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate (PubChem CID 9467715) has the molecular formula C18H17N3O4
and a molecular weight of 339.35 g/mol. Its IUPAC name is ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate |
| PubChem CID | 9467715 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)nc2c1c(=O)[nH]c(=O)n2CC |
| InChI | InChI=1S/C18H17N3O4/c1-3-21-15-14(16(22)20-18(21)24)12(17(23)25-4-2)10-13(19-15)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H,20,22,24) |
| InChIKey | KWVNMCMBYDPFJZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate?
The IUPAC name of ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate (CID 9467715) is ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate is CCOC(=O)c1cc(-c2ccccc2)nc2c1c(=O)[nH]c(=O)n2CC.
What is the InChIKey of ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate?
The InChIKey is KWVNMCMBYDPFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O4/c1-3-21-15-14(16(22)20-18(21)24)12(17(23)25-4-2)10-13(19-15)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H,20,22,24).
What are the key properties of ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate?
ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate has a molecular weight of 339.35 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylate is sourced from PubChem (CID 9467715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).