C17H16N4O3S — CID 102410512
ethyl 7-amino-1-methyl-4-oxo-5-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 102410512) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is ethyl 7-amino-1-methyl-4-oxo-5-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-amino-1-methyl-4-oxo-5-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 102410512 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | ethyl 7-amino-1-methyl-4-oxo-5-phenyl-2-sulfanylidenepyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1c(N)nc2c(c1-c1ccccc1)c(=O)[nH]c(=S)n2C |
| InChI | InChI=1S/C17H16N4O3S/c1-3-24-16(23)11-10(9-7-5-4-6-8-9)12-14(19-13(11)18)21(2)17(25)20-15(12)22/h4-8H,3H2,1-2H3,(H2,18,19)(H,20,22,25) |
| InChIKey | ZEFWNIYLUNOENI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|