C16H28N5O2+ — CID 164781924
8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl-methylazanium (PubChem CID 164781924) has the molecular formula C16H28N5O2+ and a molecular weight of 322.43 g/mol. Its IUPAC name is 8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl-methylazanium.
| Compound Name | 8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl-methylazanium |
|---|---|
| PubChem CID | 164781924 |
| Molecular Formula | C16H28N5O2+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 8-(3,8-dimethyl-2,6-dioxopurin-7-yl)octyl-methylazanium |
| SMILES | C[NH2+]CCCCCCCCn1c(C)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H27N5O2/c1-12-18-14-13(15(22)19-16(23)20(14)3)21(12)11-9-7-5-4-6-8-10-17-2/h17H,4-11H2,1-3H3,(H,19,22,23)/p+1 |
| InChIKey | ARKHTGGPJUUURZ-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|