C15H23N5O4 — CID 89149955
2,2-dideuterio-N-methoxy-N-methyl-5-(3,7,8-trimethyl-2,6-dioxopurin-1-yl)pentanamide (PubChem CID 89149955) has the molecular formula C15H23N5O4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2,2-dideuterio-N-methoxy-N-methyl-5-(3,7,8-trimethyl-2,6-dioxopurin-1-yl)pentanamide.
| Compound Name | 2,2-dideuterio-N-methoxy-N-methyl-5-(3,7,8-trimethyl-2,6-dioxopurin-1-yl)pentanamide |
|---|---|
| PubChem CID | 89149955 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2,2-dideuterio-N-methoxy-N-methyl-5-(3,7,8-trimethyl-2,6-dioxopurin-1-yl)pentanamide |
| SMILES | [2H]C([2H])(CCCn1c(=O)c2c(nc(C)n2C)n(C)c1=O)C(=O)N(C)OC |
| InChI | InChI=1S/C15H23N5O4/c1-10-16-13-12(17(10)2)14(22)20(15(23)18(13)3)9-7-6-8-11(21)19(4)24-5/h6-9H2,1-5H3/i8D2 |
| InChIKey | SBKXQRMDYKYQFU-MGVXTIMCSA-N |
| XLogP | -0.07 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|