C11H16N4O5S — CID 59939552
3-(methoxymethylsulfonylmethyl)-1,7,8-trimethylpurine-2,6-dione (PubChem CID 59939552) has the molecular formula C11H16N4O5S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-(methoxymethylsulfonylmethyl)-1,7,8-trimethylpurine-2,6-dione.
| Compound Name | 3-(methoxymethylsulfonylmethyl)-1,7,8-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 59939552 |
| Molecular Formula | C11H16N4O5S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-(methoxymethylsulfonylmethyl)-1,7,8-trimethylpurine-2,6-dione |
| SMILES | COCS(=O)(=O)Cn1c(=O)n(C)c(=O)c2c1nc(C)n2C |
| InChI | InChI=1S/C11H16N4O5S/c1-7-12-9-8(13(7)2)10(16)14(3)11(17)15(9)5-21(18,19)6-20-4/h5-6H2,1-4H3 |
| InChIKey | AANQIDPKCNJTTJ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |