C17H26N4O4 — CID 58164568
1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl-8-(3-oxobutyl)purine-2,6-dione (PubChem CID 58164568) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl-8-(3-oxobutyl)purine-2,6-dione.
| Compound Name | 1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl-8-(3-oxobutyl)purine-2,6-dione |
|---|---|
| PubChem CID | 58164568 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[(5R)-5-hydroxyhexyl]-3,7-dimethyl-8-(3-oxobutyl)purine-2,6-dione |
| SMILES | CC(=O)CCc1nc2c(c(=O)n(CCCC[C@@H](C)O)c(=O)n2C)n1C |
| InChI | InChI=1S/C17H26N4O4/c1-11(22)7-5-6-10-21-16(24)14-15(20(4)17(21)25)18-13(19(14)3)9-8-12(2)23/h11,22H,5-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | WVPPWIUCHSQKFO-LLVKDONJSA-N |
| XLogP | 0.51 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|