C17H27ClN4O4S — CID 69153971
8-(2-chloroethylsulfanyl)-7-(ethoxymethyl)-1-[(5R)-5-hydroxyhexyl]-3-methylpurine-2,6-dione (PubChem CID 69153971) has the molecular formula C17H27ClN4O4S and a molecular weight of 418.95 g/mol. Its IUPAC name is 8-(2-chloroethylsulfanyl)-7-(ethoxymethyl)-1-[(5R)-5-hydroxyhexyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(2-chloroethylsulfanyl)-7-(ethoxymethyl)-1-[(5R)-5-hydroxyhexyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 69153971 |
| Molecular Formula | C17H27ClN4O4S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 8-(2-chloroethylsulfanyl)-7-(ethoxymethyl)-1-[(5R)-5-hydroxyhexyl]-3-methylpurine-2,6-dione |
| SMILES | CCOCn1c(SCCCl)nc2c1c(=O)n(CCCC[C@@H](C)O)c(=O)n2C |
| InChI | InChI=1S/C17H27ClN4O4S/c1-4-26-11-22-13-14(19-16(22)27-10-8-18)20(3)17(25)21(15(13)24)9-6-5-7-12(2)23/h12,23H,4-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | HVRKBQSMILDIOA-GFCCVEGCSA-N |
| XLogP | 1.77 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|