C19H29N5O6 — CID 174470165
N-[7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-2,6-dioxopurin-8-yl]-2-hydroxyacetamide (PubChem CID 174470165) has the molecular formula C19H29N5O6 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-2,6-dioxopurin-8-yl]-2-hydroxyacetamide.
| Compound Name | N-[7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-2,6-dioxopurin-8-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 174470165 |
| Molecular Formula | C19H29N5O6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-[7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-2,6-dioxopurin-8-yl]-2-hydroxyacetamide |
| SMILES | CCOCn1c(NC(=O)CO)nc2c1c(=O)n(CCCC[C@@H](C)C(C)=O)c(=O)n2C |
| InChI | InChI=1S/C19H29N5O6/c1-5-30-11-24-15-16(21-18(24)20-14(27)10-25)22(4)19(29)23(17(15)28)9-7-6-8-12(2)13(3)26/h12,25H,5-11H2,1-4H3,(H,20,21,27)/t12-/m1/s1 |
| InChIKey | IASARAWWYWNMJI-GFCCVEGCSA-N |
| XLogP | 0.22 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|