C17H26N4O4S — CID 141061087
7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-8-sulfanylidene-9H-purine-2,6-dione (PubChem CID 141061087) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-8-sulfanylidene-9H-purine-2,6-dione.
| Compound Name | 7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-8-sulfanylidene-9H-purine-2,6-dione |
|---|---|
| PubChem CID | 141061087 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 7-(ethoxymethyl)-3-methyl-1-[(5R)-5-methyl-6-oxoheptyl]-8-sulfanylidene-9H-purine-2,6-dione |
| SMILES | CCOCn1c(=S)[nH]c2c1c(=O)n(CCCC[C@@H](C)C(C)=O)c(=O)n2C |
| InChI | InChI=1S/C17H26N4O4S/c1-5-25-10-21-13-14(18-16(21)26)19(4)17(24)20(15(13)23)9-7-6-8-11(2)12(3)22/h11H,5-10H2,1-4H3,(H,18,26)/t11-/m1/s1 |
| InChIKey | SDWTZRWGRKPNDV-LLVKDONJSA-N |
| XLogP | 1.95 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|