C18H29N5O5 — CID 22499073
6-[7-(ethoxymethyl)-3-methyl-8-(methylamino)-2,6-dioxopurin-1-yl]hexan-2-yl acetate (PubChem CID 22499073) has the molecular formula C18H29N5O5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 6-[7-(ethoxymethyl)-3-methyl-8-(methylamino)-2,6-dioxopurin-1-yl]hexan-2-yl acetate.
| Compound Name | 6-[7-(ethoxymethyl)-3-methyl-8-(methylamino)-2,6-dioxopurin-1-yl]hexan-2-yl acetate |
|---|---|
| PubChem CID | 22499073 |
| Molecular Formula | C18H29N5O5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 6-[7-(ethoxymethyl)-3-methyl-8-(methylamino)-2,6-dioxopurin-1-yl]hexan-2-yl acetate |
| SMILES | CCOCn1c(NC)nc2c1c(=O)n(CCCCC(C)OC(C)=O)c(=O)n2C |
| InChI | InChI=1S/C18H29N5O5/c1-6-27-11-23-14-15(20-17(23)19-4)21(5)18(26)22(16(14)25)10-8-7-9-12(2)28-13(3)24/h12H,6-11H2,1-5H3,(H,19,20) |
| InChIKey | GGTQXIMIIUKRGU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|