C18H26N4O4 — CID 22631305
6-[1,7-dimethyl-5-(methylamino)-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]hexan-2-yl acetate (PubChem CID 22631305) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 6-[1,7-dimethyl-5-(methylamino)-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]hexan-2-yl acetate.
| Compound Name | 6-[1,7-dimethyl-5-(methylamino)-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]hexan-2-yl acetate |
|---|---|
| PubChem CID | 22631305 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 6-[1,7-dimethyl-5-(methylamino)-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]hexan-2-yl acetate |
| SMILES | CNc1cc(C)nc2c1c(=O)n(CCCCC(C)OC(C)=O)c(=O)n2C |
| InChI | InChI=1S/C18H26N4O4/c1-11-10-14(19-4)15-16(20-11)21(5)18(25)22(17(15)24)9-7-6-8-12(2)26-13(3)23/h10,12H,6-9H2,1-5H3,(H,19,20) |
| InChIKey | KARDQURYCMBKSN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|