C18H24F3N5O5 — CID 87980060
6-[3-methyl-9-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,6-dioxopurin-1-yl]hexan-2-yl acetate (PubChem CID 87980060) has the molecular formula C18H24F3N5O5 and a molecular weight of 447.41 g/mol. Its IUPAC name is 6-[3-methyl-9-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,6-dioxopurin-1-yl]hexan-2-yl acetate.
| Compound Name | 6-[3-methyl-9-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,6-dioxopurin-1-yl]hexan-2-yl acetate |
|---|---|
| PubChem CID | 87980060 |
| Molecular Formula | C18H24F3N5O5 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 6-[3-methyl-9-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,6-dioxopurin-1-yl]hexan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCCCn1c(=O)c2ncn(CN(C)C(=O)C(F)(F)F)c2n(C)c1=O |
| InChI | InChI=1S/C18H24F3N5O5/c1-11(31-12(2)27)7-5-6-8-26-15(28)13-14(24(4)17(26)30)25(9-22-13)10-23(3)16(29)18(19,20)21/h9,11H,5-8,10H2,1-4H3 |
| InChIKey | PTOYXLBHBNOCSZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 108.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|