C16H23N5O4 — CID 10150076
6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 10150076) has the molecular formula C16H23N5O4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 10150076 |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 6-acetyl-2-[(5R)-5-hydroxyhexyl]-4-methyl-7,8-dihydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CC(=O)N1CCn2c1nc1c2c(=O)n(CCCC[C@@H](C)O)c(=O)n1C |
| InChI | InChI=1S/C16H23N5O4/c1-10(22)6-4-5-7-21-14(24)12-13(18(3)16(21)25)17-15-19(11(2)23)8-9-20(12)15/h10,22H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | RCTAUPSNOPCAIQ-SNVBAGLBSA-N |
| XLogP | -0.19 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|