C17H27N5O2 — CID 71172441
2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-7,8-dihydro-6H-purino[7,8-a]pyrrole-1,3-dione (PubChem CID 71172441) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-7,8-dihydro-6H-purino[7,8-a]pyrrole-1,3-dione.
| Compound Name | 2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-7,8-dihydro-6H-purino[7,8-a]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 71172441 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-7,8-dihydro-6H-purino[7,8-a]pyrrole-1,3-dione |
| SMILES | C[C@H](CCCCn1c(=O)c2c(nc3n2CCC3)n(C)c1=O)N(C)C |
| InChI | InChI=1S/C17H27N5O2/c1-12(19(2)3)8-5-6-10-22-16(23)14-15(20(4)17(22)24)18-13-9-7-11-21(13)14/h12H,5-11H2,1-4H3/t12-/m1/s1 |
| InChIKey | FNJSYCIKYXGUNY-GFCCVEGCSA-N |
| XLogP | 0.96 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|