C23H34N6O2 — CID 59997015
7-benzyl-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-8-(methylaminomethyl)purine-2,6-dione (PubChem CID 59997015) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 7-benzyl-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-8-(methylaminomethyl)purine-2,6-dione.
| Compound Name | 7-benzyl-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-8-(methylaminomethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 59997015 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 7-benzyl-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-8-(methylaminomethyl)purine-2,6-dione |
| SMILES | CNCc1nc2c(c(=O)n(CCCC[C@@H](C)N(C)C)c(=O)n2C)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H34N6O2/c1-17(26(3)4)11-9-10-14-28-22(30)20-21(27(5)23(28)31)25-19(15-24-2)29(20)16-18-12-7-6-8-13-18/h6-8,12-13,17,24H,9-11,14-16H2,1-5H3/t17-/m1/s1 |
| InChIKey | KPVBTVXOIRCAHW-QGZVFWFLSA-N |
| XLogP | 1.78 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|