C18H28N4O2S — CID 3097605
2-decyl-4-methyl-7,8-dihydropurino[8,7-b][1,3]thiazole-1,3-dione (PubChem CID 3097605) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is 2-decyl-4-methyl-7,8-dihydropurino[8,7-b][1,3]thiazole-1,3-dione.
| Compound Name | 2-decyl-4-methyl-7,8-dihydropurino[8,7-b][1,3]thiazole-1,3-dione |
|---|---|
| PubChem CID | 3097605 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-decyl-4-methyl-7,8-dihydropurino[8,7-b][1,3]thiazole-1,3-dione |
| SMILES | CCCCCCCCCCn1c(=O)c2c(nc3n2CCS3)n(C)c1=O |
| InChI | InChI=1S/C18H28N4O2S/c1-3-4-5-6-7-8-9-10-11-22-16(23)14-15(20(2)18(22)24)19-17-21(14)12-13-25-17/h3-13H2,1-2H3 |
| InChIKey | FMNZSBLELMDOTA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|