C15H26N6O2 — CID 54426005
8-(aminomethyl)-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-7H-purine-2,6-dione (PubChem CID 54426005) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 8-(aminomethyl)-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(aminomethyl)-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 54426005 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 8-(aminomethyl)-1-[(5R)-5-(dimethylamino)hexyl]-3-methyl-7H-purine-2,6-dione |
| SMILES | C[C@H](CCCCn1c(=O)c2[nH]c(CN)nc2n(C)c1=O)N(C)C |
| InChI | InChI=1S/C15H26N6O2/c1-10(19(2)3)7-5-6-8-21-14(22)12-13(20(4)15(21)23)18-11(9-16)17-12/h10H,5-9,16H2,1-4H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | WECZHFOODGCRTM-SNVBAGLBSA-N |
| XLogP | 0.00 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|