C17H23N5O4 — CID 24815894
8-(furan-2-ylmethylamino)-1-(5-hydroxyhexyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 24815894) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 8-(furan-2-ylmethylamino)-1-(5-hydroxyhexyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(furan-2-ylmethylamino)-1-(5-hydroxyhexyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 24815894 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 8-(furan-2-ylmethylamino)-1-(5-hydroxyhexyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | CC(O)CCCCn1c(=O)c2[nH]c(NCc3ccco3)nc2n(C)c1=O |
| InChI | InChI=1S/C17H23N5O4/c1-11(23)6-3-4-8-22-15(24)13-14(21(2)17(22)25)20-16(19-13)18-10-12-7-5-9-26-12/h5,7,9,11,23H,3-4,6,8,10H2,1-2H3,(H2,18,19,20) |
| InChIKey | KTRVBQVOKBKTDP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|