C17H22N4O4 — CID 15481611
3-(furan-2-ylmethyl)-1-[(5S)-5-hydroxyhexyl]-8-methyl-7H-purine-2,6-dione (PubChem CID 15481611) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1-[(5S)-5-hydroxyhexyl]-8-methyl-7H-purine-2,6-dione.
| Compound Name | 3-(furan-2-ylmethyl)-1-[(5S)-5-hydroxyhexyl]-8-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 15481611 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1-[(5S)-5-hydroxyhexyl]-8-methyl-7H-purine-2,6-dione |
| SMILES | Cc1nc2c([nH]1)c(=O)n(CCCC[C@H](C)O)c(=O)n2Cc1ccco1 |
| InChI | InChI=1S/C17H22N4O4/c1-11(22)6-3-4-8-20-16(23)14-15(19-12(2)18-14)21(17(20)24)10-13-7-5-9-25-13/h5,7,9,11,22H,3-4,6,8,10H2,1-2H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | QLEPBBBJIFQYAM-NSHDSACASA-N |
| XLogP | 1.39 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|