C16H26N4O4 — CID 139612140
8-(ethoxymethyl)-1-(5-hydroxy-5-methylhexyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 139612140) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 8-(ethoxymethyl)-1-(5-hydroxy-5-methylhexyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(ethoxymethyl)-1-(5-hydroxy-5-methylhexyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 139612140 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 8-(ethoxymethyl)-1-(5-hydroxy-5-methylhexyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | CCOCc1nc2c([nH]1)c(=O)n(CCCCC(C)(C)O)c(=O)n2C |
| InChI | InChI=1S/C16H26N4O4/c1-5-24-10-11-17-12-13(18-11)19(4)15(22)20(14(12)21)9-7-6-8-16(2,3)23/h23H,5-10H2,1-4H3,(H,17,18) |
| InChIKey | MVCJUWDSUNDGMR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|