C13H21ClN4O3 — CID 172653196
1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione;hydrochloride (PubChem CID 172653196) has the molecular formula C13H21ClN4O3 and a molecular weight of 322.83 g/mol. Its IUPAC name is 1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione;hydrochloride.
| Compound Name | 1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 172653196 |
| Molecular Formula | C13H21ClN4O3 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])n1cnc2c1c(=O)n(CCCCC(C)O)c(=O)n2C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H20N4O3.ClH/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20;/h8-9,18H,4-7H2,1-3H3;1H/i2D3,3D3; |
| InChIKey | GMDWPLPWPUAONX-HVTBMTIBSA-N |
| XLogP | 0.41 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|