C13H20N4O3 — CID 51040758
8-deuterio-1-[(5S)-4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl]-3,7-bis(trideuteriomethyl)purine-2,6-dione (PubChem CID 51040758) has the molecular formula C13H20N4O3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 8-deuterio-1-[(5S)-4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl]-3,7-bis(trideuteriomethyl)purine-2,6-dione.
| Compound Name | 8-deuterio-1-[(5S)-4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl]-3,7-bis(trideuteriomethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 51040758 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 8-deuterio-1-[(5S)-4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl]-3,7-bis(trideuteriomethyl)purine-2,6-dione |
| SMILES | [2H]c1nc2c(c(=O)n(CCCC([2H])([2H])[C@]([2H])(O)C([2H])([2H])[2H])c(=O)n2C([2H])([2H])[2H])n1C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H20N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8-9,18H,4-7H2,1-3H3/t9-/m1/s1/i1D3,2D3,3D3,6D2,8D,9D |
| InChIKey | NSMXQKNUPPXBRG-DSUIHOGDSA-N |
| XLogP | -0.02 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |