C14H21N3O3 — CID 51035591
3-(4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl)-1-methyl-5-(trideuteriomethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 51035591) has the molecular formula C14H21N3O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl)-1-methyl-5-(trideuteriomethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl)-1-methyl-5-(trideuteriomethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51035591 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3-(4,4,5,6,6,6-hexadeuterio-5-hydroxyhexyl)-1-methyl-5-(trideuteriomethyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | [2H]C([2H])([2H])c1c[nH]c2c1c(=O)n(CCCC([2H])([2H])C([2H])(O)C([2H])([2H])[2H])c(=O)n2C |
| InChI | InChI=1S/C14H21N3O3/c1-9-8-15-12-11(9)13(19)17(14(20)16(12)3)7-5-4-6-10(2)18/h8,10,15,18H,4-7H2,1-3H3/i1D3,2D3,6D2,10D |
| InChIKey | IOOWZXGEARRRJX-YWOMKFNCSA-N |
| XLogP | 0.89 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |