C13H18F2N4O2 — CID 51000827
8-deuterio-3-methyl-1-(4,4,6,6,6-pentadeuterio-5,5-difluorohexyl)-7-(trideuteriomethyl)purine-2,6-dione (PubChem CID 51000827) has the molecular formula C13H18F2N4O2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 8-deuterio-3-methyl-1-(4,4,6,6,6-pentadeuterio-5,5-difluorohexyl)-7-(trideuteriomethyl)purine-2,6-dione.
| Compound Name | 8-deuterio-3-methyl-1-(4,4,6,6,6-pentadeuterio-5,5-difluorohexyl)-7-(trideuteriomethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 51000827 |
| Molecular Formula | C13H18F2N4O2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 8-deuterio-3-methyl-1-(4,4,6,6,6-pentadeuterio-5,5-difluorohexyl)-7-(trideuteriomethyl)purine-2,6-dione |
| SMILES | [2H]c1nc2c(c(=O)n(CCCC([2H])([2H])C(F)(F)C([2H])([2H])[2H])c(=O)n2C)n1C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H18F2N4O2/c1-13(14,15)6-4-5-7-19-11(20)9-10(16-8-17(9)2)18(3)12(19)21/h8H,4-7H2,1-3H3/i1D3,2D3,6D2,8D |
| InChIKey | BQWJGOJWRDQYOC-YSRYKXKTSA-N |
| XLogP | 1.26 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |