C9H12N4O2 — CID 158385905
8-deuterio-1-ethyl-3,7-bis(trideuteriomethyl)purine-2,6-dione (PubChem CID 158385905) has the molecular formula C9H12N4O2 and a molecular weight of 215.26 g/mol. Its IUPAC name is 8-deuterio-1-ethyl-3,7-bis(trideuteriomethyl)purine-2,6-dione.
| Compound Name | 8-deuterio-1-ethyl-3,7-bis(trideuteriomethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 158385905 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 8-deuterio-1-ethyl-3,7-bis(trideuteriomethyl)purine-2,6-dione |
| SMILES | [2H]c1nc2c(c(=O)n(CC)c(=O)n2C([2H])([2H])[2H])n1C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H12N4O2/c1-4-13-8(14)6-7(10-5-11(6)2)12(3)9(13)15/h5H,4H2,1-3H3/i2D3,3D3,5D |
| InChIKey | KRVVZPXPQUPXJE-LUUPTHFTSA-N |
| XLogP | -0.55 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |