C13H20N4O2 — CID 71815282
7-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexyl)-3-(trideuteriomethyl)purine-2,6-dione (PubChem CID 71815282) has the molecular formula C13H20N4O2 and a molecular weight of 280.43 g/mol. Its IUPAC name is 7-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexyl)-3-(trideuteriomethyl)purine-2,6-dione.
| Compound Name | 7-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexyl)-3-(trideuteriomethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 71815282 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 7-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexyl)-3-(trideuteriomethyl)purine-2,6-dione |
| SMILES | [2H]C([2H])([2H])n1c(=O)n(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])c(=O)c2c1ncn2C |
| InChI | InChI=1S/C13H20N4O2/c1-4-5-6-7-8-17-12(18)10-11(14-9-15(10)2)16(3)13(17)19/h9H,4-8H2,1-3H3/i1D3,3D3,4D2,5D2,6D2,7D2,8D2 |
| InChIKey | MRWQRJMESRRJJB-QWFKULEZSA-N |
| XLogP | 1.01 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |