C15H23N3O3 — CID 51036011
6-deuterio-5,7-dimethyl-3-(5,6,6,6-tetradeuterio-5-hydroxyhexyl)-1-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 51036011) has the molecular formula C15H23N3O3 and a molecular weight of 301.42 g/mol. Its IUPAC name is 6-deuterio-5,7-dimethyl-3-(5,6,6,6-tetradeuterio-5-hydroxyhexyl)-1-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-deuterio-5,7-dimethyl-3-(5,6,6,6-tetradeuterio-5-hydroxyhexyl)-1-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51036011 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 6-deuterio-5,7-dimethyl-3-(5,6,6,6-tetradeuterio-5-hydroxyhexyl)-1-(trideuteriomethyl)pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | [2H]c1c(C)c2c(=O)n(CCCCC([2H])(O)C([2H])([2H])[2H])c(=O)n(C([2H])([2H])[2H])c2n1C |
| InChI | InChI=1S/C15H23N3O3/c1-10-9-16(3)13-12(10)14(20)18(15(21)17(13)4)8-6-5-7-11(2)19/h9,11,19H,5-8H2,1-4H3/i2D3,4D3,9D,11D |
| InChIKey | BWNWXLMMNRIIFA-YPEUVWOVSA-N |
| XLogP | 0.90 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|