C14H19N3O3 — CID 51037048
1,5-dimethyl-3-(6,6,6-trideuterio-5-oxohexyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 51037048) has the molecular formula C14H19N3O3 and a molecular weight of 280.34 g/mol. Its IUPAC name is 1,5-dimethyl-3-(6,6,6-trideuterio-5-oxohexyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,5-dimethyl-3-(6,6,6-trideuterio-5-oxohexyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51037048 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1,5-dimethyl-3-(6,6,6-trideuterio-5-oxohexyl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | [2H]C([2H])([2H])C(=O)CCCCn1c(=O)c2c(C)c[nH]c2n(C)c1=O |
| InChI | InChI=1S/C14H19N3O3/c1-9-8-15-12-11(9)13(19)17(14(20)16(12)3)7-5-4-6-10(2)18/h8,15H,4-7H2,1-3H3/i2D3 |
| InChIKey | BTVWDFGYMIWZJQ-BMSJAHLVSA-N |
| XLogP | 1.10 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|