C46H54N8O4 — CID 156714243
8-[6-(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]-3,7-dimethyl-1-octylpurine-2,6-dione (PubChem CID 156714243) has the molecular formula C46H54N8O4 and a molecular weight of 782.99 g/mol. Its IUPAC name is 8-[6-(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]-3,7-dimethyl-1-octylpurine-2,6-dione.
| Compound Name | 8-[6-(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]-3,7-dimethyl-1-octylpurine-2,6-dione |
|---|---|
| PubChem CID | 156714243 |
| Molecular Formula | C46H54N8O4 |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.43 |
| IUPAC Name | 8-[6-(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]-3,7-dimethyl-1-octylpurine-2,6-dione |
| SMILES | CCCCCCCCn1c(=O)c2c(nc(-c3ccc4ccc5c(-c6nc7c(c(=O)n(CCCCCCCC)c(=O)n7C)n6C)ccc6ccc3c4c65)n2C)n(C)c1=O |
| InChI | InChI=1S/C46H54N8O4/c1-7-9-11-13-15-17-27-53-43(55)37-41(51(5)45(53)57)47-39(49(37)3)33-25-21-29-20-24-32-34(26-22-30-19-23-31(33)35(29)36(30)32)40-48-42-38(50(40)4)44(56)54(46(58)52(42)6)28-18-16-14-12-10-8-2/h19-26H,7-18,27-28H2,1-6H3 |
| InChIKey | IBPHJAOTAWGPDM-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 123.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|