C20H30N4O3 — CID 22109428
7-tert-butyl-4-methyl-2-octylpurino[8,7-b][1,3]oxazole-1,3-dione (PubChem CID 22109428) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 7-tert-butyl-4-methyl-2-octylpurino[8,7-b][1,3]oxazole-1,3-dione.
| Compound Name | 7-tert-butyl-4-methyl-2-octylpurino[8,7-b][1,3]oxazole-1,3-dione |
|---|---|
| PubChem CID | 22109428 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 7-tert-butyl-4-methyl-2-octylpurino[8,7-b][1,3]oxazole-1,3-dione |
| SMILES | CCCCCCCCn1c(=O)c2c(nc3oc(C(C)(C)C)cn32)n(C)c1=O |
| InChI | InChI=1S/C20H30N4O3/c1-6-7-8-9-10-11-12-23-17(25)15-16(22(5)19(23)26)21-18-24(15)13-14(27-18)20(2,3)4/h13H,6-12H2,1-5H3 |
| InChIKey | VWRUKPDOROXOED-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|