C13H16N4O4 — CID 16810790
2-(2-ethoxyethyl)-4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione (PubChem CID 16810790) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione.
| Compound Name | 2-(2-ethoxyethyl)-4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione |
|---|---|
| PubChem CID | 16810790 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(2-ethoxyethyl)-4,7-dimethylpurino[8,7-b][1,3]oxazole-1,3-dione |
| SMILES | CCOCCn1c(=O)c2c(nc3oc(C)cn32)n(C)c1=O |
| InChI | InChI=1S/C13H16N4O4/c1-4-20-6-5-16-11(18)9-10(15(3)13(16)19)14-12-17(9)7-8(2)21-12/h7H,4-6H2,1-3H3 |
| InChIKey | DCTHCRIXPKZEMK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 83.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|