C20H33BrN4O5Si — CID 90402652
8-bromo-3-methyl-1-[3-(oxan-2-yloxy)propyl]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90402652) has the molecular formula C20H33BrN4O5Si and a molecular weight of 517.50 g/mol. Its IUPAC name is 8-bromo-3-methyl-1-[3-(oxan-2-yloxy)propyl]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 8-bromo-3-methyl-1-[3-(oxan-2-yloxy)propyl]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90402652 |
| Molecular Formula | C20H33BrN4O5Si |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 8-bromo-3-methyl-1-[3-(oxan-2-yloxy)propyl]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(Br)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H33BrN4O5Si/c1-23-17-16(25(19(21)22-17)14-28-12-13-31(2,3)4)18(26)24(20(23)27)9-7-11-30-15-8-5-6-10-29-15/h15H,5-14H2,1-4H3 |
| InChIKey | LIPOSNJLPGAOQZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|