About 2-(3-nitropropoxy)oxane
2-(3-nitropropoxy)oxane (PubChem CID 13425358) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-(3-nitropropoxy)oxane.
Molecular Properties
| Compound Name | 2-(3-nitropropoxy)oxane |
| PubChem CID | 13425358 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2-(3-nitropropoxy)oxane |
| SMILES | O=[N+]([O-])CCCOC1CCCCO1 |
| InChI | InChI=1S/C8H15NO4/c10-9(11)5-3-7-13-8-4-1-2-6-12-8/h8H,1-7H2 |
| InChIKey | BOFJQXDJPKTPKY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitropropoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitropropoxy)oxane?
The IUPAC name of 2-(3-nitropropoxy)oxane (CID 13425358) is 2-(3-nitropropoxy)oxane.
What is the SMILES notation for 2-(3-nitropropoxy)oxane?
The canonical SMILES for 2-(3-nitropropoxy)oxane is O=[N+]([O-])CCCOC1CCCCO1.
What is the InChIKey of 2-(3-nitropropoxy)oxane?
The InChIKey is BOFJQXDJPKTPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4/c10-9(11)5-3-7-13-8-4-1-2-6-12-8/h8H,1-7H2.
What are the key properties of 2-(3-nitropropoxy)oxane?
2-(3-nitropropoxy)oxane has a molecular weight of 189.21 g/mol, XLogP of 1.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitropropoxy)oxane is sourced from PubChem (CID 13425358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).