About 2-(2-nitroethoxy)oxane
2-(2-nitroethoxy)oxane (PubChem CID 3748656) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(2-nitroethoxy)oxane.
Molecular Properties
| Compound Name | 2-(2-nitroethoxy)oxane |
| PubChem CID | 3748656 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-(2-nitroethoxy)oxane |
| SMILES | O=[N+]([O-])CCOC1CCCCO1 |
| InChI | InChI=1S/C7H13NO4/c9-8(10)4-6-12-7-3-1-2-5-11-7/h7H,1-6H2 |
| InChIKey | KQDXRRAVDLIMGM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitroethoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitroethoxy)oxane?
The IUPAC name of 2-(2-nitroethoxy)oxane (CID 3748656) is 2-(2-nitroethoxy)oxane.
What is the SMILES notation for 2-(2-nitroethoxy)oxane?
The canonical SMILES for 2-(2-nitroethoxy)oxane is O=[N+]([O-])CCOC1CCCCO1.
What is the InChIKey of 2-(2-nitroethoxy)oxane?
The InChIKey is KQDXRRAVDLIMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c9-8(10)4-6-12-7-3-1-2-5-11-7/h7H,1-6H2.
What are the key properties of 2-(2-nitroethoxy)oxane?
2-(2-nitroethoxy)oxane has a molecular weight of 175.18 g/mol, XLogP of 0.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitroethoxy)oxane is sourced from PubChem (CID 3748656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).