About 2-(2-nitroethyl)oxane
2-(2-nitroethyl)oxane (PubChem CID 14765796) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is 2-(2-nitroethyl)oxane.
Molecular Properties
| Compound Name | 2-(2-nitroethyl)oxane |
| PubChem CID | 14765796 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-(2-nitroethyl)oxane |
| SMILES | O=[N+]([O-])CCC1CCCCO1 |
| InChI | InChI=1S/C7H13NO3/c9-8(10)5-4-7-3-1-2-6-11-7/h7H,1-6H2 |
| InChIKey | AOBVBWAKRZCMSK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitroethyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitroethyl)oxane?
The IUPAC name of 2-(2-nitroethyl)oxane (CID 14765796) is 2-(2-nitroethyl)oxane.
What is the SMILES notation for 2-(2-nitroethyl)oxane?
The canonical SMILES for 2-(2-nitroethyl)oxane is O=[N+]([O-])CCC1CCCCO1.
What is the InChIKey of 2-(2-nitroethyl)oxane?
The InChIKey is AOBVBWAKRZCMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c9-8(10)5-4-7-3-1-2-6-11-7/h7H,1-6H2.
What are the key properties of 2-(2-nitroethyl)oxane?
2-(2-nitroethyl)oxane has a molecular weight of 159.18 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitroethyl)oxane is sourced from PubChem (CID 14765796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).