C30H35FN6O5 — CID 162781734
8-(5-cyclobutyloxypyrazin-2-yl)-3-ethyl-7-[(4-fluorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione (PubChem CID 162781734) has the molecular formula C30H35FN6O5 and a molecular weight of 578.65 g/mol. Its IUPAC name is 8-(5-cyclobutyloxypyrazin-2-yl)-3-ethyl-7-[(4-fluorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione.
| Compound Name | 8-(5-cyclobutyloxypyrazin-2-yl)-3-ethyl-7-[(4-fluorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 162781734 |
| Molecular Formula | C30H35FN6O5 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 8-(5-cyclobutyloxypyrazin-2-yl)-3-ethyl-7-[(4-fluorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]purine-2,6-dione |
| SMILES | CCn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1nc(-c1cnc(OC3CCC3)cn1)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C30H35FN6O5/c1-2-35-28-26(29(38)36(30(35)39)14-6-16-41-25-9-3-4-15-40-25)37(19-20-10-12-21(31)13-11-20)27(34-28)23-17-33-24(18-32-23)42-22-7-5-8-22/h10-13,17-18,22,25H,2-9,14-16,19H2,1H3 |
| InChIKey | PPINKLZSNLHECL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 115.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|