C34H43N5O5 — CID 148924465
7-benzyl-8-[2-methyl-6-(3-methylcyclobutyl)oxy-3-pyridinyl]-1-[3-(oxan-2-yloxy)propyl]-3-propan-2-ylpurine-2,6-dione (PubChem CID 148924465) has the molecular formula C34H43N5O5 and a molecular weight of 601.75 g/mol. Its IUPAC name is 7-benzyl-8-[2-methyl-6-(3-methylcyclobutyl)oxy-3-pyridinyl]-1-[3-(oxan-2-yloxy)propyl]-3-propan-2-ylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-[2-methyl-6-(3-methylcyclobutyl)oxy-3-pyridinyl]-1-[3-(oxan-2-yloxy)propyl]-3-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 148924465 |
| Molecular Formula | C34H43N5O5 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.33 |
| IUPAC Name | 7-benzyl-8-[2-methyl-6-(3-methylcyclobutyl)oxy-3-pyridinyl]-1-[3-(oxan-2-yloxy)propyl]-3-propan-2-ylpurine-2,6-dione |
| SMILES | Cc1nc(OC2CC(C)C2)ccc1-c1nc2c(c(=O)n(CCCOC3CCCCO3)c(=O)n2C(C)C)n1Cc1ccccc1 |
| InChI | InChI=1S/C34H43N5O5/c1-22(2)39-32-30(33(40)37(34(39)41)16-10-18-43-29-13-8-9-17-42-29)38(21-25-11-6-5-7-12-25)31(36-32)27-14-15-28(35-24(27)4)44-26-19-23(3)20-26/h5-7,11-12,14-15,22-23,26,29H,8-10,13,16-21H2,1-4H3 |
| InChIKey | PKSLTBAOJXQZCH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 102.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|