C32H38ClN5O4 — CID 154938087
7-[(4-chlorophenyl)methyl]-8-(6-cyclobutyloxy-3-pyridinyl)-3-ethyl-6-methylidene-1-[3-(oxan-2-yloxy)propyl]purin-2-one (PubChem CID 154938087) has the molecular formula C32H38ClN5O4 and a molecular weight of 592.14 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-(6-cyclobutyloxy-3-pyridinyl)-3-ethyl-6-methylidene-1-[3-(oxan-2-yloxy)propyl]purin-2-one.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-(6-cyclobutyloxy-3-pyridinyl)-3-ethyl-6-methylidene-1-[3-(oxan-2-yloxy)propyl]purin-2-one |
|---|---|
| PubChem CID | 154938087 |
| Molecular Formula | C32H38ClN5O4 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-(6-cyclobutyloxy-3-pyridinyl)-3-ethyl-6-methylidene-1-[3-(oxan-2-yloxy)propyl]purin-2-one |
| SMILES | C=C1c2c(nc(-c3ccc(OC4CCC4)nc3)n2Cc2ccc(Cl)cc2)N(CC)C(=O)N1CCCOC1CCCCO1 |
| InChI | InChI=1S/C32H38ClN5O4/c1-3-36-31-29(22(2)37(32(36)39)17-7-19-41-28-10-4-5-18-40-28)38(21-23-11-14-25(33)15-12-23)30(35-31)24-13-16-27(34-20-24)42-26-8-6-9-26/h11-16,20,26,28H,2-10,17-19,21H2,1H3 |
| InChIKey | AIPHMVPNPLWHAD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 81.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|