C29H40ClN4O6+ — CID 144707218
7-[(4-chlorophenyl)methyl]-8-(2-cyclohexyloxyethoxy)-3-methyl-1-[3-(oxan-2-yloxy)propyl]-9H-purin-7-ium-2,6-dione (PubChem CID 144707218) has the molecular formula C29H40ClN4O6+ and a molecular weight of 576.11 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-(2-cyclohexyloxyethoxy)-3-methyl-1-[3-(oxan-2-yloxy)propyl]-9H-purin-7-ium-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-(2-cyclohexyloxyethoxy)-3-methyl-1-[3-(oxan-2-yloxy)propyl]-9H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 144707218 |
| Molecular Formula | C29H40ClN4O6+ |
| Molecular Weight | 576.11 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-(2-cyclohexyloxyethoxy)-3-methyl-1-[3-(oxan-2-yloxy)propyl]-9H-purin-7-ium-2,6-dione |
| SMILES | Cn1c(=O)n(CCCOC2CCCCO2)c(=O)c2c1[nH]c(OCCOC1CCCCC1)[n+]2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H39ClN4O6/c1-32-26-25(27(35)33(29(32)36)15-7-17-39-24-10-5-6-16-38-24)34(20-21-11-13-22(30)14-12-21)28(31-26)40-19-18-37-23-8-3-2-4-9-23/h11-14,23-24H,2-10,15-20H2,1H3/p+1 |
| InChIKey | QXGJOIHSRRYEGX-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.11 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|