C29H30ClF3N4O7 — CID 144762284
7-[(4-chlorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-3H-purine-2,6-dione (PubChem CID 144762284) has the molecular formula C29H30ClF3N4O7 and a molecular weight of 639.03 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-3H-purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 144762284 |
| Molecular Formula | C29H30ClF3N4O7 |
| Molecular Weight | 639.03 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1-[3-(oxan-2-yloxy)propyl]-8-[2-[3-(trifluoromethoxy)phenoxy]ethoxy]-3H-purine-2,6-dione |
| SMILES | O=c1[nH]c2nc(OCCOc3cccc(OC(F)(F)F)c3)n(Cc3ccc(Cl)cc3)c2c(=O)n1CCCOC1CCCCO1 |
| InChI | InChI=1S/C29H30ClF3N4O7/c30-20-10-8-19(9-11-20)18-37-24-25(34-27(39)36(26(24)38)12-4-14-42-23-7-1-2-13-41-23)35-28(37)43-16-15-40-21-5-3-6-22(17-21)44-29(31,32)33/h3,5-6,8-11,17,23H,1-2,4,7,12-16,18H2,(H,34,39) |
| InChIKey | OIMHHJSCAWASBD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.03 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|